ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester
S-(2-pyrazin-2-ylethyl) ethanethioate
CAS: 59021-07-7
Molecular Formula: C8H10N2OS
ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester - Names and Identifiers
| Name | S-(2-pyrazin-2-ylethyl) ethanethioate |
| Synonyms | β-Pyrazinylethiol acetate β-PYRAZINYLETHIOL ACETATE SS-PYRAZINYLETHIOL ACETATE ??????-Pyrazinylethiol acetate S-(2-pyrazin-2-ylethyl) ethanethioate S-[2-(Pyrazin-2-yl)ethyl] ethanethioate Ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester |
| CAS | 59021-07-7 |
| InChI | InChI=1/C8H10N2OS/c1-7(11)12-5-2-8-6-9-3-4-10-8/h3-4,6H,2,5H2,1H3 |
ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester - Physico-chemical Properties
| Molecular Formula | C8H10N2OS |
| Molar Mass | 182.24 |
| Density | 1.192±0.06 g/cm3(Predicted) |
| Boling Point | 294.5±30.0 °C(Predicted) |
| Flash Point | 131.9°C |
| Vapor Presure | 0.00162mmHg at 25°C |
| pKa | 0.95±0.10(Predicted) |
| Refractive Index | 1.558 |
ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester - Introduction
S-(2-pyrazin-2-ylethyl) ethanethioate is an organic compound with a chemical formula of C10H12N2S and a common trade name of EDTP. The following is a detailed description of the nature, use, preparation and safety information of S-(2-pyrazin-2-ylethyl) ethanethioate:
Nature:
1. Appearance: S-(2-pyrazin-2-ylethyl) ethanethioate is a white crystalline solid.
2. Solubility: It is soluble in common organic solvents, such as ethanol and dimethyl sulfoxide.
Use:
1. S-(2-pyrazin-2-ylethyl) ethanethioate can be used as a coordination reagent for the synthesis and catalytic reaction of metal complexes.
2. It is also widely used in the removal of carboxylic acid protecting groups in organic synthesis.
Preparation Method:
S-(2-pyrazin-2-ylethyl) ethanethioate is prepared as follows:
2-Pyrazinyl ethanethiol (2-pyrazin-2-ylethyl) reacts with ethyl bromoacetate (bromoethylethanoate) to generate the corresponding mercaptoethylpyrazine acetate (2-pyrazin-2-ylethyl ethanethioate), which is then treated with alkali to obtain S-(2-prazin-2-ylethyl) ethanethioate.
Safety Information:
1. S-(2-pyrazin-2-ylethyl) ethanethioate is irritating to skin, eyes and mucous membranes and should be avoided when using.
2. in the operation should pay attention to avoid inhalation or intake of the compound, to maintain a good ventilation environment.
3. If exposed to the compound, immediately rinse the affected area with plenty of water and seek medical help.
4. Store S-(2-pyrazin-2-ylethyl) ethanethioate in a dry and cool place to avoid contact with oxidants and strong acids.
Nature:
1. Appearance: S-(2-pyrazin-2-ylethyl) ethanethioate is a white crystalline solid.
2. Solubility: It is soluble in common organic solvents, such as ethanol and dimethyl sulfoxide.
Use:
1. S-(2-pyrazin-2-ylethyl) ethanethioate can be used as a coordination reagent for the synthesis and catalytic reaction of metal complexes.
2. It is also widely used in the removal of carboxylic acid protecting groups in organic synthesis.
Preparation Method:
S-(2-pyrazin-2-ylethyl) ethanethioate is prepared as follows:
2-Pyrazinyl ethanethiol (2-pyrazin-2-ylethyl) reacts with ethyl bromoacetate (bromoethylethanoate) to generate the corresponding mercaptoethylpyrazine acetate (2-pyrazin-2-ylethyl ethanethioate), which is then treated with alkali to obtain S-(2-prazin-2-ylethyl) ethanethioate.
Safety Information:
1. S-(2-pyrazin-2-ylethyl) ethanethioate is irritating to skin, eyes and mucous membranes and should be avoided when using.
2. in the operation should pay attention to avoid inhalation or intake of the compound, to maintain a good ventilation environment.
3. If exposed to the compound, immediately rinse the affected area with plenty of water and seek medical help.
4. Store S-(2-pyrazin-2-ylethyl) ethanethioate in a dry and cool place to avoid contact with oxidants and strong acids.
Last Update：2024-04-10 22:29:15
![ethanethioic acid, S-[2-(2-pyrazinyl)ethyl] ester](http://res.chembk.com/assets/str/2d/5/59/59021-07-7.png)